C9H5F5O2 — CID 63039667
3-(2,3,4,5,6-pentafluorophenoxy)propanal (PubChem CID 63039667) has the molecular formula C9H5F5O2 and a molecular weight of 240.13 g/mol. Its IUPAC name is 3-(2,3,4,5,6-pentafluorophenoxy)propanal.
| Compound Name | 3-(2,3,4,5,6-pentafluorophenoxy)propanal |
|---|---|
| PubChem CID | 63039667 |
| Molecular Formula | C9H5F5O2 |
| Molecular Weight | 240.13 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 3-(2,3,4,5,6-pentafluorophenoxy)propanal |
| SMILES | O=CCCOc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C9H5F5O2/c10-4-5(11)7(13)9(8(14)6(4)12)16-3-1-2-15/h2H,1,3H2 |
| InChIKey | UBMKUWNLIUQFKO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.13 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|