C7H3F5O2 — CID 87333321
(2,3,4,5,6-pentafluorophenoxy)methanol (PubChem CID 87333321) has the molecular formula C7H3F5O2 and a molecular weight of 214.09 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenoxy)methanol.
| Compound Name | (2,3,4,5,6-pentafluorophenoxy)methanol |
|---|---|
| PubChem CID | 87333321 |
| Molecular Formula | C7H3F5O2 |
| Molecular Weight | 214.09 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenoxy)methanol |
| SMILES | OCOc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C7H3F5O2/c8-2-3(9)5(11)7(14-1-13)6(12)4(2)10/h13H,1H2 |
| InChIKey | VKPKDBAYEWWICB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.09 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|