C18H14F10NO2+ — CID 155656975
dimethyl-bis[2-(2,3,4,5,6-pentafluorophenoxy)ethyl]azanium (PubChem CID 155656975) has the molecular formula C18H14F10NO2+ and a molecular weight of 466.30 g/mol. Its IUPAC name is dimethyl-bis[2-(2,3,4,5,6-pentafluorophenoxy)ethyl]azanium.
| Compound Name | dimethyl-bis[2-(2,3,4,5,6-pentafluorophenoxy)ethyl]azanium |
|---|---|
| PubChem CID | 155656975 |
| Molecular Formula | C18H14F10NO2+ |
| Molecular Weight | 466.30 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | dimethyl-bis[2-(2,3,4,5,6-pentafluorophenoxy)ethyl]azanium |
| SMILES | C[N+](C)(CCOc1c(F)c(F)c(F)c(F)c1F)CCOc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H14F10NO2/c1-29(2,3-5-30-17-13(25)9(21)7(19)10(22)14(17)26)4-6-31-18-15(27)11(23)8(20)12(24)16(18)28/h3-6H2,1-2H3/q+1 |
| InChIKey | MZTSROIIOVJNSF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.30 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|