C11H15F3NO+ — CID 155656953
trimethyl-[2-(3,4,5-trifluorophenoxy)ethyl]azanium (PubChem CID 155656953) has the molecular formula C11H15F3NO+ and a molecular weight of 234.24 g/mol. Its IUPAC name is trimethyl-[2-(3,4,5-trifluorophenoxy)ethyl]azanium.
| Compound Name | trimethyl-[2-(3,4,5-trifluorophenoxy)ethyl]azanium |
|---|---|
| PubChem CID | 155656953 |
| Molecular Formula | C11H15F3NO+ |
| Molecular Weight | 234.24 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | trimethyl-[2-(3,4,5-trifluorophenoxy)ethyl]azanium |
| SMILES | C[N+](C)(C)CCOc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C11H15F3NO/c1-15(2,3)4-5-16-8-6-9(12)11(14)10(13)7-8/h6-7H,4-5H2,1-3H3/q+1 |
| InChIKey | YAAIHHWHFRTPFS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|