C19H16F6O3 — CID 123631065
(3,4,5-trifluorophenyl) 7-(3,4,5-trifluorophenoxy)heptanoate (PubChem CID 123631065) has the molecular formula C19H16F6O3 and a molecular weight of 406.32 g/mol. Its IUPAC name is (3,4,5-trifluorophenyl) 7-(3,4,5-trifluorophenoxy)heptanoate.
| Compound Name | (3,4,5-trifluorophenyl) 7-(3,4,5-trifluorophenoxy)heptanoate |
|---|---|
| PubChem CID | 123631065 |
| Molecular Formula | C19H16F6O3 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | (3,4,5-trifluorophenyl) 7-(3,4,5-trifluorophenoxy)heptanoate |
| SMILES | O=C(CCCCCCOc1cc(F)c(F)c(F)c1)Oc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C19H16F6O3/c20-13-7-11(8-14(21)18(13)24)27-6-4-2-1-3-5-17(26)28-12-9-15(22)19(25)16(23)10-12/h7-10H,1-6H2 |
| InChIKey | WWCZNYKQGJXNQS-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|