C12H12F3NO — CID 91656735
6-(3,4,5-trifluorophenoxy)hexanenitrile (PubChem CID 91656735) has the molecular formula C12H12F3NO and a molecular weight of 243.23 g/mol. Its IUPAC name is 6-(3,4,5-trifluorophenoxy)hexanenitrile.
| Compound Name | 6-(3,4,5-trifluorophenoxy)hexanenitrile |
|---|---|
| PubChem CID | 91656735 |
| Molecular Formula | C12H12F3NO |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 6-(3,4,5-trifluorophenoxy)hexanenitrile |
| SMILES | N#CCCCCCOc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C12H12F3NO/c13-10-7-9(8-11(14)12(10)15)17-6-4-2-1-3-5-16/h7-8H,1-4,6H2 |
| InChIKey | BRDBJBIMOVZMTL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|