C13H17NO3 — CID 55025373
5-(3,5-dimethoxyphenoxy)pentanenitrile (PubChem CID 55025373) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 5-(3,5-dimethoxyphenoxy)pentanenitrile.
| Compound Name | 5-(3,5-dimethoxyphenoxy)pentanenitrile |
|---|---|
| PubChem CID | 55025373 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 5-(3,5-dimethoxyphenoxy)pentanenitrile |
| SMILES | COc1cc(OC)cc(OCCCCC#N)c1 |
| InChI | InChI=1S/C13H17NO3/c1-15-11-8-12(16-2)10-13(9-11)17-7-5-3-4-6-14/h8-10H,3-5,7H2,1-2H3 |
| InChIKey | GESLYEROMBACOA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|