C13H17NO — CID 83940113
4-(4-methoxy-2,6-dimethylphenyl)butanenitrile (PubChem CID 83940113) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 4-(4-methoxy-2,6-dimethylphenyl)butanenitrile.
| Compound Name | 4-(4-methoxy-2,6-dimethylphenyl)butanenitrile |
|---|---|
| PubChem CID | 83940113 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 4-(4-methoxy-2,6-dimethylphenyl)butanenitrile |
| SMILES | COc1cc(C)c(CCCC#N)c(C)c1 |
| InChI | InChI=1S/C13H17NO/c1-10-8-12(15-3)9-11(2)13(10)6-4-5-7-14/h8-9H,4-6H2,1-3H3 |
| InChIKey | LHTRRHIRSNGGRF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|