C11H15BrO3 — CID 12959383
1-(3-bromopropoxy)-3,5-dimethoxybenzene (PubChem CID 12959383) has the molecular formula C11H15BrO3 and a molecular weight of 275.14 g/mol. Its IUPAC name is 1-(3-bromopropoxy)-3,5-dimethoxybenzene.
| Compound Name | 1-(3-bromopropoxy)-3,5-dimethoxybenzene |
|---|---|
| PubChem CID | 12959383 |
| Molecular Formula | C11H15BrO3 |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 1-(3-bromopropoxy)-3,5-dimethoxybenzene |
| SMILES | COc1cc(OC)cc(OCCCBr)c1 |
| InChI | InChI=1S/C11H15BrO3/c1-13-9-6-10(14-2)8-11(7-9)15-5-3-4-12/h6-8H,3-5H2,1-2H3 |
| InChIKey | DGWBWOKDQKZWKZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|