C14H26O3S — CID 144886217
2-(3,5-dimethoxyphenoxy)ethanethiol;ethane (PubChem CID 144886217) has the molecular formula C14H26O3S and a molecular weight of 274.43 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenoxy)ethanethiol;ethane.
| Compound Name | 2-(3,5-dimethoxyphenoxy)ethanethiol;ethane |
|---|---|
| PubChem CID | 144886217 |
| Molecular Formula | C14H26O3S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 2-(3,5-dimethoxyphenoxy)ethanethiol;ethane |
| SMILES | CC.CC.COc1cc(OC)cc(OCCS)c1 |
| InChI | InChI=1S/C10H14O3S.2C2H6/c1-11-8-5-9(12-2)7-10(6-8)13-3-4-14;2*1-2/h5-7,14H,3-4H2,1-2H3;2*1-2H3 |
| InChIKey | QYVIWKJDAQWHGC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|