C10H14O4 — CID 11194953
1,3-dimethoxy-5-(methoxymethoxy)benzene (PubChem CID 11194953) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is 1,3-dimethoxy-5-(methoxymethoxy)benzene.
| Compound Name | 1,3-dimethoxy-5-(methoxymethoxy)benzene |
|---|---|
| PubChem CID | 11194953 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 1,3-dimethoxy-5-(methoxymethoxy)benzene |
| SMILES | COCOc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C10H14O4/c1-11-7-14-10-5-8(12-2)4-9(6-10)13-3/h4-6H,7H2,1-3H3 |
| InChIKey | SPMOTZIIHLEZKL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|