C10H12Br2O4 — CID 21364580
1,3-dibromo-2,5-bis(methoxymethoxy)benzene (PubChem CID 21364580) has the molecular formula C10H12Br2O4 and a molecular weight of 356.01 g/mol. Its IUPAC name is 1,3-dibromo-2,5-bis(methoxymethoxy)benzene.
| Compound Name | 1,3-dibromo-2,5-bis(methoxymethoxy)benzene |
|---|---|
| PubChem CID | 21364580 |
| Molecular Formula | C10H12Br2O4 |
| Molecular Weight | 356.01 g/mol |
| Exact Mass | 353.91 |
| IUPAC Name | 1,3-dibromo-2,5-bis(methoxymethoxy)benzene |
| SMILES | COCOc1cc(Br)c(OCOC)c(Br)c1 |
| InChI | InChI=1S/C10H12Br2O4/c1-13-5-15-7-3-8(11)10(9(12)4-7)16-6-14-2/h3-4H,5-6H2,1-2H3 |
| InChIKey | KBRHJEZBGGPUKL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.01 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|