C13H21NO3 — CID 55137875
5-(3,5-dimethoxyphenoxy)pentan-2-amine (PubChem CID 55137875) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 5-(3,5-dimethoxyphenoxy)pentan-2-amine.
| Compound Name | 5-(3,5-dimethoxyphenoxy)pentan-2-amine |
|---|---|
| PubChem CID | 55137875 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 5-(3,5-dimethoxyphenoxy)pentan-2-amine |
| SMILES | COc1cc(OC)cc(OCCCC(C)N)c1 |
| InChI | InChI=1S/C13H21NO3/c1-10(14)5-4-6-17-13-8-11(15-2)7-12(9-13)16-3/h7-10H,4-6,14H2,1-3H3 |
| InChIKey | BTRRWTSFKBLWBF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|