C17H28N2O4 — CID 119344793
2-amino-N-[3-(3,5-dimethoxyphenoxy)propyl]-N-methylpentanamide (PubChem CID 119344793) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is 2-amino-N-[3-(3,5-dimethoxyphenoxy)propyl]-N-methylpentanamide.
| Compound Name | 2-amino-N-[3-(3,5-dimethoxyphenoxy)propyl]-N-methylpentanamide |
|---|---|
| PubChem CID | 119344793 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 2-amino-N-[3-(3,5-dimethoxyphenoxy)propyl]-N-methylpentanamide |
| SMILES | CCCC(N)C(=O)N(C)CCCOc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C17H28N2O4/c1-5-7-16(18)17(20)19(2)8-6-9-23-15-11-13(21-3)10-14(12-15)22-4/h10-12,16H,5-9,18H2,1-4H3 |
| InChIKey | XMYXQCQFQGVPJF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|