C10H13BrO2 — CID 12560827
1-(2-bromoethyl)-3,5-dimethoxybenzene (PubChem CID 12560827) has the molecular formula C10H13BrO2 and a molecular weight of 245.12 g/mol. Its IUPAC name is 1-(2-bromoethyl)-3,5-dimethoxybenzene.
| Compound Name | 1-(2-bromoethyl)-3,5-dimethoxybenzene |
|---|---|
| PubChem CID | 12560827 |
| Molecular Formula | C10H13BrO2 |
| Molecular Weight | 245.12 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | 1-(2-bromoethyl)-3,5-dimethoxybenzene |
| SMILES | COc1cc(CCBr)cc(OC)c1 |
| InChI | InChI=1S/C10H13BrO2/c1-12-9-5-8(3-4-11)6-10(7-9)13-2/h5-7H,3-4H2,1-2H3 |
| InChIKey | UAEVVYMBABKZOM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.12 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|