C19H17BrO5 — CID 174622145
3-(2-bromoethyl)-1,6,8-trimethoxyanthracene-9,10-dione (PubChem CID 174622145) has the molecular formula C19H17BrO5 and a molecular weight of 405.24 g/mol. Its IUPAC name is 3-(2-bromoethyl)-1,6,8-trimethoxyanthracene-9,10-dione.
| Compound Name | 3-(2-bromoethyl)-1,6,8-trimethoxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 174622145 |
| Molecular Formula | C19H17BrO5 |
| Molecular Weight | 405.24 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | 3-(2-bromoethyl)-1,6,8-trimethoxyanthracene-9,10-dione |
| SMILES | COc1cc(OC)c2c(c1)C(=O)c1cc(CCBr)cc(OC)c1C2=O |
| InChI | InChI=1S/C19H17BrO5/c1-23-11-8-13-17(15(9-11)25-3)19(22)16-12(18(13)21)6-10(4-5-20)7-14(16)24-2/h6-9H,4-5H2,1-3H3 |
| InChIKey | RNFKEJVSJPFASE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|