C17H12Br2O5 — CID 14563117
6-(dibromomethyl)-1-hydroxy-3,8-dimethoxyanthracene-9,10-dione (PubChem CID 14563117) has the molecular formula C17H12Br2O5 and a molecular weight of 456.09 g/mol. Its IUPAC name is 6-(dibromomethyl)-1-hydroxy-3,8-dimethoxyanthracene-9,10-dione.
| Compound Name | 6-(dibromomethyl)-1-hydroxy-3,8-dimethoxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 14563117 |
| Molecular Formula | C17H12Br2O5 |
| Molecular Weight | 456.09 g/mol |
| Exact Mass | 453.91 |
| IUPAC Name | 6-(dibromomethyl)-1-hydroxy-3,8-dimethoxyanthracene-9,10-dione |
| SMILES | COc1cc(O)c2c(c1)C(=O)c1cc(C(Br)Br)cc(OC)c1C2=O |
| InChI | InChI=1S/C17H12Br2O5/c1-23-8-5-10-13(11(20)6-8)16(22)14-9(15(10)21)3-7(17(18)19)4-12(14)24-2/h3-6,17,20H,1-2H3 |
| InChIKey | HQJRADRJHHXNRX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.09 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|