C17H14O4 — CID 59981445
1-hydroxy-6-methoxy-3,8-dimethylanthracene-9,10-dione (PubChem CID 59981445) has the molecular formula C17H14O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is 1-hydroxy-6-methoxy-3,8-dimethylanthracene-9,10-dione.
| Compound Name | 1-hydroxy-6-methoxy-3,8-dimethylanthracene-9,10-dione |
|---|---|
| PubChem CID | 59981445 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 1-hydroxy-6-methoxy-3,8-dimethylanthracene-9,10-dione |
| SMILES | COc1cc(C)c2c(c1)C(=O)c1cc(C)cc(O)c1C2=O |
| InChI | InChI=1S/C17H14O4/c1-8-4-11-15(13(18)5-8)17(20)14-9(2)6-10(21-3)7-12(14)16(11)19/h4-7,18H,1-3H3 |
| InChIKey | LWGDQTZNCZKZHL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|