C17H14O6 — CID 163064188
3,8-dihydroxy-2,6-dimethoxy-1-methylanthracene-9,10-dione (PubChem CID 163064188) has the molecular formula C17H14O6 and a molecular weight of 314.29 g/mol. Its IUPAC name is 3,8-dihydroxy-2,6-dimethoxy-1-methylanthracene-9,10-dione.
| Compound Name | 3,8-dihydroxy-2,6-dimethoxy-1-methylanthracene-9,10-dione |
|---|---|
| PubChem CID | 163064188 |
| Molecular Formula | C17H14O6 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 3,8-dihydroxy-2,6-dimethoxy-1-methylanthracene-9,10-dione |
| SMILES | COc1cc(O)c2c(c1)C(=O)c1cc(O)c(OC)c(C)c1C2=O |
| InChI | InChI=1S/C17H14O6/c1-7-13-10(6-12(19)17(7)23-3)15(20)9-4-8(22-2)5-11(18)14(9)16(13)21/h4-6,18-19H,1-3H3 |
| InChIKey | HUJAVTBSGOADPG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|