C18H16O4 — CID 156580717
3,6-dihydroxy-1,2,7,8-tetramethylanthracene-9,10-dione (PubChem CID 156580717) has the molecular formula C18H16O4 and a molecular weight of 296.32 g/mol. Its IUPAC name is 3,6-dihydroxy-1,2,7,8-tetramethylanthracene-9,10-dione.
| Compound Name | 3,6-dihydroxy-1,2,7,8-tetramethylanthracene-9,10-dione |
|---|---|
| PubChem CID | 156580717 |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 3,6-dihydroxy-1,2,7,8-tetramethylanthracene-9,10-dione |
| SMILES | Cc1c(O)cc2c(c1C)C(=O)c1c(cc(O)c(C)c1C)C2=O |
| InChI | InChI=1S/C18H16O4/c1-7-9(3)15-11(5-13(7)19)17(21)12-6-14(20)8(2)10(4)16(12)18(15)22/h5-6,19-20H,1-4H3 |
| InChIKey | ZAZUWPWZNFAFMS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|