About 7-hydroxy-2-methoxy-1,6-dimethylanthracene-9,10-dione
7-hydroxy-2-methoxy-1,6-dimethylanthracene-9,10-dione (PubChem CID 156783023) has the molecular formula C17H14O4
and a molecular weight of 282.30 g/mol. Its IUPAC name is 7-hydroxy-2-methoxy-1,6-dimethylanthracene-9,10-dione.
Molecular Properties
| Compound Name | 7-hydroxy-2-methoxy-1,6-dimethylanthracene-9,10-dione |
| PubChem CID | 156783023 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 7-hydroxy-2-methoxy-1,6-dimethylanthracene-9,10-dione |
| SMILES | COc1ccc2c(c1C)C(=O)c1cc(O)c(C)cc1C2=O |
| InChI | InChI=1S/C17H14O4/c1-8-6-11-12(7-13(8)18)17(20)15-9(2)14(21-3)5-4-10(15)16(11)19/h4-7,18H,1-3H3 |
| InChIKey | MHMIIVKIIIZXOB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 7-hydroxy-2-methoxy-1,6-dimethylanthracene-9,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-2-methoxy-1,6-dimethylanthracene-9,10-dione?
The IUPAC name of 7-hydroxy-2-methoxy-1,6-dimethylanthracene-9,10-dione (CID 156783023) is 7-hydroxy-2-methoxy-1,6-dimethylanthracene-9,10-dione.
What is the SMILES notation for 7-hydroxy-2-methoxy-1,6-dimethylanthracene-9,10-dione?
The canonical SMILES for 7-hydroxy-2-methoxy-1,6-dimethylanthracene-9,10-dione is COc1ccc2c(c1C)C(=O)c1cc(O)c(C)cc1C2=O.
What is the InChIKey of 7-hydroxy-2-methoxy-1,6-dimethylanthracene-9,10-dione?
The InChIKey is MHMIIVKIIIZXOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14O4/c1-8-6-11-12(7-13(8)18)17(20)15-9(2)14(21-3)5-4-10(15)16(11)19/h4-7,18H,1-3H3.
What are the key properties of 7-hydroxy-2-methoxy-1,6-dimethylanthracene-9,10-dione?
7-hydroxy-2-methoxy-1,6-dimethylanthracene-9,10-dione has a molecular weight of 282.30 g/mol, XLogP of 2.79, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-2-methoxy-1,6-dimethylanthracene-9,10-dione is sourced from PubChem (CID 156783023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).