C17H14O4 — CID 156783023
7-hydroxy-2-methoxy-1,6-dimethylanthracene-9,10-dione (PubChem CID 156783023) has the molecular formula C17H14O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is 7-hydroxy-2-methoxy-1,6-dimethylanthracene-9,10-dione.
| Compound Name | 7-hydroxy-2-methoxy-1,6-dimethylanthracene-9,10-dione |
|---|---|
| PubChem CID | 156783023 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 7-hydroxy-2-methoxy-1,6-dimethylanthracene-9,10-dione |
| SMILES | COc1ccc2c(c1C)C(=O)c1cc(O)c(C)cc1C2=O |
| InChI | InChI=1S/C17H14O4/c1-8-6-11-12(7-13(8)18)17(20)15-9(2)14(21-3)5-4-10(15)16(11)19/h4-7,18H,1-3H3 |
| InChIKey | MHMIIVKIIIZXOB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|