C20H16O8 — CID 100997919
(6-acetyloxy-1-hydroxy-5-methoxy-7-methyl-9,10-dioxoanthracen-2-yl) acetate (PubChem CID 100997919) has the molecular formula C20H16O8 and a molecular weight of 384.34 g/mol. Its IUPAC name is (6-acetyloxy-1-hydroxy-5-methoxy-7-methyl-9,10-dioxoanthracen-2-yl) acetate.
| Compound Name | (6-acetyloxy-1-hydroxy-5-methoxy-7-methyl-9,10-dioxoanthracen-2-yl) acetate |
|---|---|
| PubChem CID | 100997919 |
| Molecular Formula | C20H16O8 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | (6-acetyloxy-1-hydroxy-5-methoxy-7-methyl-9,10-dioxoanthracen-2-yl) acetate |
| SMILES | COc1c(OC(C)=O)c(C)cc2c1C(=O)c1ccc(OC(C)=O)c(O)c1C2=O |
| InChI | InChI=1S/C20H16O8/c1-8-7-12-15(20(26-4)19(8)28-10(3)22)16(23)11-5-6-13(27-9(2)21)18(25)14(11)17(12)24/h5-7,25H,1-4H3 |
| InChIKey | CHSHBMPXWNSLNM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|