C16H12O5 — CID 162876842
1,3-dihydroxy-6-methoxy-7-methylanthracene-9,10-dione (PubChem CID 162876842) has the molecular formula C16H12O5 and a molecular weight of 284.27 g/mol. Its IUPAC name is 1,3-dihydroxy-6-methoxy-7-methylanthracene-9,10-dione.
| Compound Name | 1,3-dihydroxy-6-methoxy-7-methylanthracene-9,10-dione |
|---|---|
| PubChem CID | 162876842 |
| Molecular Formula | C16H12O5 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 1,3-dihydroxy-6-methoxy-7-methylanthracene-9,10-dione |
| SMILES | COc1cc2c(cc1C)C(=O)c1c(O)cc(O)cc1C2=O |
| InChI | InChI=1S/C16H12O5/c1-7-3-9-10(6-13(7)21-2)15(19)11-4-8(17)5-12(18)14(11)16(9)20/h3-6,17-18H,1-2H3 |
| InChIKey | MVPDGALUEVCVTB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|