C18H14O8 — CID 46201084
methyl 3,6,8-trihydroxy-4-methoxy-1-methyl-9,10-dioxoanthracene-2-carboxylate (PubChem CID 46201084) has the molecular formula C18H14O8 and a molecular weight of 358.30 g/mol. Its IUPAC name is methyl 3,6,8-trihydroxy-4-methoxy-1-methyl-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | methyl 3,6,8-trihydroxy-4-methoxy-1-methyl-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 46201084 |
| Molecular Formula | C18H14O8 |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | methyl 3,6,8-trihydroxy-4-methoxy-1-methyl-9,10-dioxoanthracene-2-carboxylate |
| SMILES | COC(=O)c1c(C)c2c(c(OC)c1O)C(=O)c1cc(O)cc(O)c1C2=O |
| InChI | InChI=1S/C18H14O8/c1-6-10-13(17(25-2)16(23)11(6)18(24)26-3)14(21)8-4-7(19)5-9(20)12(8)15(10)22/h4-5,19-20,23H,1-3H3 |
| InChIKey | QQKYEIPWELLTRP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|