C17H14O7 — CID 170989098
7-[(1R,2S)-1,2-dihydroxypropyl]-1,3,6-trihydroxyanthracene-9,10-dione (PubChem CID 170989098) has the molecular formula C17H14O7 and a molecular weight of 330.29 g/mol. Its IUPAC name is 7-[(1R,2S)-1,2-dihydroxypropyl]-1,3,6-trihydroxyanthracene-9,10-dione.
| Compound Name | 7-[(1R,2S)-1,2-dihydroxypropyl]-1,3,6-trihydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 170989098 |
| Molecular Formula | C17H14O7 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 7-[(1R,2S)-1,2-dihydroxypropyl]-1,3,6-trihydroxyanthracene-9,10-dione |
| SMILES | C[C@H](O)C(O)c1cc2c(cc1O)C(=O)c1cc(O)cc(O)c1C2=O |
| InChI | InChI=1S/C17H14O7/c1-6(18)15(22)10-4-8-9(5-12(10)20)16(23)11-2-7(19)3-13(21)14(11)17(8)24/h2-6,15,18-22H,1H3/t6-,15?/m0/s1 |
| InChIKey | KIHWIBCJAITQKC-DJMHDKPGSA-N |
| XLogP | 0.99 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|