C17H16O4 — CID 134936509
2-but-3-en-2-yl-5,7-dihydroxy-3-prop-2-enylnaphthalene-1,4-dione (PubChem CID 134936509) has the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. Its IUPAC name is 2-but-3-en-2-yl-5,7-dihydroxy-3-prop-2-enylnaphthalene-1,4-dione.
| Compound Name | 2-but-3-en-2-yl-5,7-dihydroxy-3-prop-2-enylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 134936509 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-but-3-en-2-yl-5,7-dihydroxy-3-prop-2-enylnaphthalene-1,4-dione |
| SMILES | C=CCC1=C(C(C)C=C)C(=O)c2cc(O)cc(O)c2C1=O |
| InChI | InChI=1S/C17H16O4/c1-4-6-11-14(9(3)5-2)17(21)12-7-10(18)8-13(19)15(12)16(11)20/h4-5,7-9,18-19H,1-2,6H2,3H3 |
| InChIKey | GLEARIGJBUXVCO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|