C15H10O7 — CID 162965748
1,4,6,8-tetrahydroxy-2-(hydroxymethyl)anthracene-9,10-dione (PubChem CID 162965748) has the molecular formula C15H10O7 and a molecular weight of 302.24 g/mol. Its IUPAC name is 1,4,6,8-tetrahydroxy-2-(hydroxymethyl)anthracene-9,10-dione.
| Compound Name | 1,4,6,8-tetrahydroxy-2-(hydroxymethyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 162965748 |
| Molecular Formula | C15H10O7 |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 1,4,6,8-tetrahydroxy-2-(hydroxymethyl)anthracene-9,10-dione |
| SMILES | O=C1c2cc(O)cc(O)c2C(=O)c2c(O)c(CO)cc(O)c21 |
| InChI | InChI=1S/C15H10O7/c16-4-5-1-8(18)11-12(13(5)20)15(22)10-7(14(11)21)2-6(17)3-9(10)19/h1-3,16-20H,4H2 |
| InChIKey | KDXMJPGHLPXNFU-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|