C17H11NO4 — CID 134937232
3-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)propanenitrile (PubChem CID 134937232) has the molecular formula C17H11NO4 and a molecular weight of 293.28 g/mol. Its IUPAC name is 3-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)propanenitrile.
| Compound Name | 3-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)propanenitrile |
|---|---|
| PubChem CID | 134937232 |
| Molecular Formula | C17H11NO4 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 3-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)propanenitrile |
| SMILES | N#CCCc1cc(O)c2c(c1O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C17H11NO4/c18-7-3-4-9-8-12(19)13-14(15(9)20)17(22)11-6-2-1-5-10(11)16(13)21/h1-2,5-6,8,19-20H,3-4H2 |
| InChIKey | GHKNVAXFNIMCGI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|