C20H20O4 — CID 102574994
1-hydroxy-4-propoxy-2-propylanthracene-9,10-dione (PubChem CID 102574994) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is 1-hydroxy-4-propoxy-2-propylanthracene-9,10-dione.
| Compound Name | 1-hydroxy-4-propoxy-2-propylanthracene-9,10-dione |
|---|---|
| PubChem CID | 102574994 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 1-hydroxy-4-propoxy-2-propylanthracene-9,10-dione |
| SMILES | CCCOc1cc(CCC)c(O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H20O4/c1-3-7-12-11-15(24-10-4-2)16-17(18(12)21)20(23)14-9-6-5-8-13(14)19(16)22/h5-6,8-9,11,21H,3-4,7,10H2,1-2H3 |
| InChIKey | QGHANAKRPYMDTG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|