C28H40N2O4 — CID 19594796
1,5-bis[2-(diethylamino)ethoxy]-4-propoxyfluoren-9-one (PubChem CID 19594796) has the molecular formula C28H40N2O4 and a molecular weight of 468.64 g/mol. Its IUPAC name is 1,5-bis[2-(diethylamino)ethoxy]-4-propoxyfluoren-9-one.
| Compound Name | 1,5-bis[2-(diethylamino)ethoxy]-4-propoxyfluoren-9-one |
|---|---|
| PubChem CID | 19594796 |
| Molecular Formula | C28H40N2O4 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.30 |
| IUPAC Name | 1,5-bis[2-(diethylamino)ethoxy]-4-propoxyfluoren-9-one |
| SMILES | CCCOc1ccc(OCCN(CC)CC)c2c1-c1c(OCCN(CC)CC)cccc1C2=O |
| InChI | InChI=1S/C28H40N2O4/c1-6-18-32-23-14-15-24(34-20-17-30(9-4)10-5)27-26(23)25-21(28(27)31)12-11-13-22(25)33-19-16-29(7-2)8-3/h11-15H,6-10,16-20H2,1-5H3 |
| InChIKey | DCNLGIVXNPZVDD-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |