C28H41N3O4 — CID 19594651
1-amino-2,5-bis[2-(diethylamino)ethoxy]-4-propoxyfluoren-9-one (PubChem CID 19594651) has the molecular formula C28H41N3O4 and a molecular weight of 483.65 g/mol. Its IUPAC name is 1-amino-2,5-bis[2-(diethylamino)ethoxy]-4-propoxyfluoren-9-one.
| Compound Name | 1-amino-2,5-bis[2-(diethylamino)ethoxy]-4-propoxyfluoren-9-one |
|---|---|
| PubChem CID | 19594651 |
| Molecular Formula | C28H41N3O4 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.31 |
| IUPAC Name | 1-amino-2,5-bis[2-(diethylamino)ethoxy]-4-propoxyfluoren-9-one |
| SMILES | CCCOc1cc(OCCN(CC)CC)c(N)c2c1-c1c(OCCN(CC)CC)cccc1C2=O |
| InChI | InChI=1S/C28H41N3O4/c1-6-16-33-22-19-23(35-18-15-31(9-4)10-5)27(29)26-25(22)24-20(28(26)32)12-11-13-21(24)34-17-14-30(7-2)8-3/h11-13,19H,6-10,14-18,29H2,1-5H3 |
| InChIKey | SYJVEFCOYOYPNK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 77.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|