C28H37N3O4 — CID 70191890
1-amino-4-methoxy-2,5-bis(2-piperidin-1-ylethoxy)fluoren-9-one (PubChem CID 70191890) has the molecular formula C28H37N3O4 and a molecular weight of 479.62 g/mol. Its IUPAC name is 1-amino-4-methoxy-2,5-bis(2-piperidin-1-ylethoxy)fluoren-9-one.
| Compound Name | 1-amino-4-methoxy-2,5-bis(2-piperidin-1-ylethoxy)fluoren-9-one |
|---|---|
| PubChem CID | 70191890 |
| Molecular Formula | C28H37N3O4 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | 1-amino-4-methoxy-2,5-bis(2-piperidin-1-ylethoxy)fluoren-9-one |
| SMILES | COc1cc(OCCN2CCCCC2)c(N)c2c1-c1c(OCCN3CCCCC3)cccc1C2=O |
| InChI | InChI=1S/C28H37N3O4/c1-33-22-19-23(35-18-16-31-13-6-3-7-14-31)27(29)26-25(22)24-20(28(26)32)9-8-10-21(24)34-17-15-30-11-4-2-5-12-30/h8-10,19H,2-7,11-18,29H2,1H3 |
| InChIKey | QZIRBDSIILCNHS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 77.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|