C29H39N3O4 — CID 70191902
1-amino-4-butoxy-2,5-bis(2-pyrrolidin-1-ylethoxy)fluoren-9-one (PubChem CID 70191902) has the molecular formula C29H39N3O4 and a molecular weight of 493.65 g/mol. Its IUPAC name is 1-amino-4-butoxy-2,5-bis(2-pyrrolidin-1-ylethoxy)fluoren-9-one.
| Compound Name | 1-amino-4-butoxy-2,5-bis(2-pyrrolidin-1-ylethoxy)fluoren-9-one |
|---|---|
| PubChem CID | 70191902 |
| Molecular Formula | C29H39N3O4 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | 1-amino-4-butoxy-2,5-bis(2-pyrrolidin-1-ylethoxy)fluoren-9-one |
| SMILES | CCCCOc1cc(OCCN2CCCC2)c(N)c2c1-c1c(OCCN3CCCC3)cccc1C2=O |
| InChI | InChI=1S/C29H39N3O4/c1-2-3-17-34-23-20-24(36-19-16-32-13-6-7-14-32)28(30)27-26(23)25-21(29(27)33)9-8-10-22(25)35-18-15-31-11-4-5-12-31/h8-10,20H,2-7,11-19,30H2,1H3 |
| InChIKey | VFBSNVSREVEGCH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 77.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|