C47H58N2O6 — CID 174391219
2-butoxy-5-[3-(diethylamino)propoxy]fluoren-9-one;2-butoxy-5-(2-pyrrolidin-1-ylethoxy)fluoren-9-one (PubChem CID 174391219) has the molecular formula C47H58N2O6 and a molecular weight of 746.99 g/mol. Its IUPAC name is 2-butoxy-5-[3-(diethylamino)propoxy]fluoren-9-one;2-butoxy-5-(2-pyrrolidin-1-ylethoxy)fluoren-9-one.
| Compound Name | 2-butoxy-5-[3-(diethylamino)propoxy]fluoren-9-one;2-butoxy-5-(2-pyrrolidin-1-ylethoxy)fluoren-9-one |
|---|---|
| PubChem CID | 174391219 |
| Molecular Formula | C47H58N2O6 |
| Molecular Weight | 746.99 g/mol |
| Exact Mass | 746.43 |
| IUPAC Name | 2-butoxy-5-[3-(diethylamino)propoxy]fluoren-9-one;2-butoxy-5-(2-pyrrolidin-1-ylethoxy)fluoren-9-one |
| SMILES | CCCCOc1ccc2c(c1)C(=O)c1cccc(OCCCN(CC)CC)c1-2.CCCCOc1ccc2c(c1)C(=O)c1cccc(OCCN3CCCC3)c1-2 |
| InChI | InChI=1S/C24H31NO3.C23H27NO3/c1-4-7-15-27-18-12-13-19-21(17-18)24(26)20-10-8-11-22(23(19)20)28-16-9-14-25(5-2)6-3;1-2-3-14-26-17-9-10-18-20(16-17)23(25)19-7-6-8-21(22(18)19)27-15-13-24-11-4-5-12-24/h8,10-13,17H,4-7,9,14-16H2,1-3H3;6-10,16H,2-5,11-15H2,1H3 |
| InChIKey | ZZIBEJQLNGVACJ-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.99 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|