C29H42N2O3 — CID 19594755
3,5-bis[4-(diethylamino)butoxy]fluoren-9-one (PubChem CID 19594755) has the molecular formula C29H42N2O3 and a molecular weight of 466.67 g/mol. Its IUPAC name is 3,5-bis[4-(diethylamino)butoxy]fluoren-9-one.
| Compound Name | 3,5-bis[4-(diethylamino)butoxy]fluoren-9-one |
|---|---|
| PubChem CID | 19594755 |
| Molecular Formula | C29H42N2O3 |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.32 |
| IUPAC Name | 3,5-bis[4-(diethylamino)butoxy]fluoren-9-one |
| SMILES | CCN(CC)CCCCOc1ccc2c(c1)-c1c(OCCCCN(CC)CC)cccc1C2=O |
| InChI | InChI=1S/C29H42N2O3/c1-5-30(6-2)18-9-11-20-33-23-16-17-24-26(22-23)28-25(29(24)32)14-13-15-27(28)34-21-12-10-19-31(7-3)8-4/h13-17,22H,5-12,18-21H2,1-4H3 |
| InChIKey | NABVQBKTCMTWQK-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|