C31H46N2O4 — CID 19594888
4-butoxy-2,5-bis[3-(diethylamino)propoxy]fluoren-9-one (PubChem CID 19594888) has the molecular formula C31H46N2O4 and a molecular weight of 510.72 g/mol. Its IUPAC name is 4-butoxy-2,5-bis[3-(diethylamino)propoxy]fluoren-9-one.
| Compound Name | 4-butoxy-2,5-bis[3-(diethylamino)propoxy]fluoren-9-one |
|---|---|
| PubChem CID | 19594888 |
| Molecular Formula | C31H46N2O4 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 510.35 |
| IUPAC Name | 4-butoxy-2,5-bis[3-(diethylamino)propoxy]fluoren-9-one |
| SMILES | CCCCOc1cc(OCCCN(CC)CC)cc2c1-c1c(OCCCN(CC)CC)cccc1C2=O |
| InChI | InChI=1S/C31H46N2O4/c1-6-11-19-37-28-23-24(35-20-13-17-32(7-2)8-3)22-26-30(28)29-25(31(26)34)15-12-16-27(29)36-21-14-18-33(9-4)10-5/h12,15-16,22-23H,6-11,13-14,17-21H2,1-5H3 |
| InChIKey | NNAZKGDMZJCDHC-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|