About 4-butoxy-2,5-bis(2-pyrrolidin-2-ylethoxy)fluoren-9-one
4-butoxy-2,5-bis(2-pyrrolidin-2-ylethoxy)fluoren-9-one (PubChem CID 19594842) has the molecular formula C29H38N2O4
and a molecular weight of 478.63 g/mol. Its IUPAC name is 4-butoxy-2,5-bis(2-pyrrolidin-2-ylethoxy)fluoren-9-one.
Molecular Properties
| Compound Name | 4-butoxy-2,5-bis(2-pyrrolidin-2-ylethoxy)fluoren-9-one |
| PubChem CID | 19594842 |
| Molecular Formula | C29H38N2O4 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | 4-butoxy-2,5-bis(2-pyrrolidin-2-ylethoxy)fluoren-9-one |
| SMILES | CCCCOc1cc(OCCC2CCCN2)cc2c1-c1c(OCCC3CCCN3)cccc1C2=O |
| InChI | InChI=1S/C29H38N2O4/c1-2-3-15-34-26-19-22(33-16-11-20-7-5-13-30-20)18-24-28(26)27-23(29(24)32)9-4-10-25(27)35-17-12-21-8-6-14-31-21/h4,9-10,18-21,30-31H,2-3,5-8,11-17H2,1H3 |
| InChIKey | HIAFLGTZDXRXCQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-butoxy-2,5-bis(2-pyrrolidin-2-ylethoxy)fluoren-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butoxy-2,5-bis(2-pyrrolidin-2-ylethoxy)fluoren-9-one?
The IUPAC name of 4-butoxy-2,5-bis(2-pyrrolidin-2-ylethoxy)fluoren-9-one (CID 19594842) is 4-butoxy-2,5-bis(2-pyrrolidin-2-ylethoxy)fluoren-9-one.
What is the SMILES notation for 4-butoxy-2,5-bis(2-pyrrolidin-2-ylethoxy)fluoren-9-one?
The canonical SMILES for 4-butoxy-2,5-bis(2-pyrrolidin-2-ylethoxy)fluoren-9-one is CCCCOc1cc(OCCC2CCCN2)cc2c1-c1c(OCCC3CCCN3)cccc1C2=O.
What is the InChIKey of 4-butoxy-2,5-bis(2-pyrrolidin-2-ylethoxy)fluoren-9-one?
The InChIKey is HIAFLGTZDXRXCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H38N2O4/c1-2-3-15-34-26-19-22(33-16-11-20-7-5-13-30-20)18-24-28(26)27-23(29(24)32)9-4-10-25(27)35-17-12-21-8-6-14-31-21/h4,9-10,18-21,30-31H,2-3,5-8,11-17H2,1H3.
What are the key properties of 4-butoxy-2,5-bis(2-pyrrolidin-2-ylethoxy)fluoren-9-one?
4-butoxy-2,5-bis(2-pyrrolidin-2-ylethoxy)fluoren-9-one has a molecular weight of 478.63 g/mol, XLogP of 5.12, 12 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butoxy-2,5-bis(2-pyrrolidin-2-ylethoxy)fluoren-9-one is sourced from PubChem (CID 19594842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).