C29H42N2O4 — CID 19594830
1,5-bis[3-(diethylamino)propoxy]-4-ethoxyfluoren-9-one (PubChem CID 19594830) has the molecular formula C29H42N2O4 and a molecular weight of 482.67 g/mol. Its IUPAC name is 1,5-bis[3-(diethylamino)propoxy]-4-ethoxyfluoren-9-one.
| Compound Name | 1,5-bis[3-(diethylamino)propoxy]-4-ethoxyfluoren-9-one |
|---|---|
| PubChem CID | 19594830 |
| Molecular Formula | C29H42N2O4 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.31 |
| IUPAC Name | 1,5-bis[3-(diethylamino)propoxy]-4-ethoxyfluoren-9-one |
| SMILES | CCOc1ccc(OCCCN(CC)CC)c2c1-c1c(OCCCN(CC)CC)cccc1C2=O |
| InChI | InChI=1S/C29H42N2O4/c1-6-30(7-2)18-12-20-34-23-15-11-14-22-26(23)27-24(33-10-5)16-17-25(28(27)29(22)32)35-21-13-19-31(8-3)9-4/h11,14-17H,6-10,12-13,18-21H2,1-5H3 |
| InChIKey | FIGDKDGFVNWIAT-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|