C35H54N2O3 — CID 154339493
2,7-bis[5-(dipropylamino)pentoxy]fluoren-9-one (PubChem CID 154339493) has the molecular formula C35H54N2O3 and a molecular weight of 550.83 g/mol. Its IUPAC name is 2,7-bis[5-(dipropylamino)pentoxy]fluoren-9-one.
| Compound Name | 2,7-bis[5-(dipropylamino)pentoxy]fluoren-9-one |
|---|---|
| PubChem CID | 154339493 |
| Molecular Formula | C35H54N2O3 |
| Molecular Weight | 550.83 g/mol |
| Exact Mass | 550.41 |
| IUPAC Name | 2,7-bis[5-(dipropylamino)pentoxy]fluoren-9-one |
| SMILES | CCCN(CCC)CCCCCOc1ccc2c(c1)C(=O)c1cc(OCCCCCN(CCC)CCC)ccc1-2 |
| InChI | InChI=1S/C35H54N2O3/c1-5-19-36(20-6-2)23-11-9-13-25-39-29-15-17-31-32-18-16-30(28-34(32)35(38)33(31)27-29)40-26-14-10-12-24-37(21-7-3)22-8-4/h15-18,27-28H,5-14,19-26H2,1-4H3 |
| InChIKey | IDKWBVBDGZSWCC-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.83 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|