C73H82N2O5 — CID 171056031
2,7-bis[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]fluoren-9-one (PubChem CID 171056031) has the molecular formula C73H82N2O5 and a molecular weight of 1067.47 g/mol. Its IUPAC name is 2,7-bis[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]fluoren-9-one.
| Compound Name | 2,7-bis[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]fluoren-9-one |
|---|---|
| PubChem CID | 171056031 |
| Molecular Formula | C73H82N2O5 |
| Molecular Weight | 1067.47 g/mol |
| Exact Mass | 1066.62 |
| IUPAC Name | 2,7-bis[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]fluoren-9-one |
| SMILES | CCCCCCOc1ccc(N(c2ccc(OCCCCCC)cc2)c2ccc(-c3ccc4c(c3)C(=O)c3cc(-c5ccc(N(c6ccc(OCCCCCC)cc6)c6ccc(OCCCCCC)cc6)cc5)ccc3-4)cc2)cc1 |
| InChI | InChI=1S/C73H82N2O5/c1-5-9-13-17-49-77-65-39-31-61(32-40-65)74(62-33-41-66(42-34-62)78-50-18-14-10-6-2)59-27-21-55(22-28-59)57-25-47-69-70-48-26-58(54-72(70)73(76)71(69)53-57)56-23-29-60(30-24-56)75(63-35-43-67(44-36-63)79-51-19-15-11-7-3)64-37-45-68(46-38-64)80-52-20-16-12-8-4/h21-48,53-54H,5-20,49-52H2,1-4H3 |
| InChIKey | YUQTXHCILUSTET-UHFFFAOYSA-N |
| XLogP | 21.01 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1067.47 |
| LogP ≤ 5 | 21.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|