C76H82N4O4 — CID 171056174
2-[2,7-bis[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]fluoren-9-ylidene]-2-isocyanoacetonitrile (PubChem CID 171056174) has the molecular formula C76H82N4O4 and a molecular weight of 1115.52 g/mol. Its IUPAC name is 2-[2,7-bis[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]fluoren-9-ylidene]-2-isocyanoacetonitrile.
| Compound Name | 2-[2,7-bis[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]fluoren-9-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 171056174 |
| Molecular Formula | C76H82N4O4 |
| Molecular Weight | 1115.52 g/mol |
| Exact Mass | 1114.63 |
| IUPAC Name | 2-[2,7-bis[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]fluoren-9-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]C(C#N)=C1c2cc(-c3ccc(N(c4ccc(OCCCCCC)cc4)c4ccc(OCCCCCC)cc4)cc3)ccc2-c2ccc(-c3ccc(N(c4ccc(OCCCCCC)cc4)c4ccc(OCCCCCC)cc4)cc3)cc21 |
| InChI | InChI=1S/C76H82N4O4/c1-6-10-14-18-50-81-67-40-32-63(33-41-67)79(64-34-42-68(43-35-64)82-51-19-15-11-7-2)61-28-22-57(23-29-61)59-26-48-71-72-49-27-60(55-74(72)76(73(71)54-59)75(56-77)78-5)58-24-30-62(31-25-58)80(65-36-44-69(45-37-65)83-52-20-16-12-8-3)66-38-46-70(47-39-66)84-53-21-17-13-9-4/h22-49,54-55H,6-21,50-53H2,1-4H3 |
| InChIKey | XZBGPJPQPHCZGT-UHFFFAOYSA-N |
| XLogP | 21.98 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1115.52 |
| LogP ≤ 5 | 21.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|