C76H82N4 — CID 171056054
2-[2,7-bis[4-(4-hexyl-N-(4-hexylphenyl)anilino)phenyl]fluoren-9-ylidene]-2-isocyanoacetonitrile (PubChem CID 171056054) has the molecular formula C76H82N4 and a molecular weight of 1051.52 g/mol. Its IUPAC name is 2-[2,7-bis[4-(4-hexyl-N-(4-hexylphenyl)anilino)phenyl]fluoren-9-ylidene]-2-isocyanoacetonitrile.
| Compound Name | 2-[2,7-bis[4-(4-hexyl-N-(4-hexylphenyl)anilino)phenyl]fluoren-9-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 171056054 |
| Molecular Formula | C76H82N4 |
| Molecular Weight | 1051.52 g/mol |
| Exact Mass | 1050.65 |
| IUPAC Name | 2-[2,7-bis[4-(4-hexyl-N-(4-hexylphenyl)anilino)phenyl]fluoren-9-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]C(C#N)=C1c2cc(-c3ccc(N(c4ccc(CCCCCC)cc4)c4ccc(CCCCCC)cc4)cc3)ccc2-c2ccc(-c3ccc(N(c4ccc(CCCCCC)cc4)c4ccc(CCCCCC)cc4)cc3)cc21 |
| InChI | InChI=1S/C76H82N4/c1-6-10-14-18-22-57-26-40-65(41-27-57)79(66-42-28-58(29-43-66)23-19-15-11-7-2)69-48-34-61(35-49-69)63-38-52-71-72-53-39-64(55-74(72)76(73(71)54-63)75(56-77)78-5)62-36-50-70(51-37-62)80(67-44-30-59(31-45-67)24-20-16-12-8-3)68-46-32-60(33-47-68)25-21-17-13-9-4/h26-55H,6-25H2,1-4H3 |
| InChIKey | MAFBOQIVMVABGC-UHFFFAOYSA-N |
| XLogP | 22.63 |
| TPSA | 34.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1051.52 |
| LogP ≤ 5 | 22.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|