C34H30N4S2 — CID 123814883
(2E)-2-[(18Z)-18-[cyano(isocyano)methylidene]-6,15-dihexyl-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaen-9-ylidene]-2-isocyanoacetonitrile (PubChem CID 123814883) has the molecular formula C34H30N4S2 and a molecular weight of 558.78 g/mol. Its IUPAC name is (2E)-2-[(18Z)-18-[cyano(isocyano)methylidene]-6,15-dihexyl-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaen-9-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2E)-2-[(18Z)-18-[cyano(isocyano)methylidene]-6,15-dihexyl-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaen-9-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 123814883 |
| Molecular Formula | C34H30N4S2 |
| Molecular Weight | 558.78 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | (2E)-2-[(18Z)-18-[cyano(isocyano)methylidene]-6,15-dihexyl-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaen-9-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1/c2cc3c(cc2-c2sc(CCCCCC)cc21)/C(=C(/C#N)[N+]#[C-])c1cc(CCCCCC)sc1-3 |
| InChI | InChI=1S/C34H30N4S2/c1-5-7-9-11-13-21-15-27-31(29(19-35)37-3)23-18-26-24(17-25(23)33(27)39-21)32(30(20-36)38-4)28-16-22(40-34(26)28)14-12-10-8-6-2/h15-18H,5-14H2,1-2H3/b31-29-,32-30+ |
| InChIKey | XIGFSWSRTUVQFB-SNQKRLHOSA-N |
| XLogP | 10.42 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.78 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|