C14H8N2S2 — CID 58922089
2-(4,10-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-ylidene)-2-isocyanoacetonitrile (PubChem CID 58922089) has the molecular formula C14H8N2S2 and a molecular weight of 268.37 g/mol. Its IUPAC name is 2-(4,10-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-ylidene)-2-isocyanoacetonitrile.
| Compound Name | 2-(4,10-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-ylidene)-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 58922089 |
| Molecular Formula | C14H8N2S2 |
| Molecular Weight | 268.37 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 2-(4,10-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-ylidene)-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]C(C#N)=C1c2cc(C)sc2-c2sc(C)cc21 |
| InChI | InChI=1S/C14H8N2S2/c1-7-4-9-12(11(6-15)16-3)10-5-8(2)18-14(10)13(9)17-7/h4-5H,1-2H3 |
| InChIKey | WHZRLRUTQGGQRE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.37 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|