C13N6O — CID 72572181
2-[2,4-bis[cyano(isocyano)methylidene]-3-oxocyclobutylidene]-2-isocyanoacetonitrile (PubChem CID 72572181) has the molecular formula C13N6O and a molecular weight of 256.18 g/mol. Its IUPAC name is 2-[2,4-bis[cyano(isocyano)methylidene]-3-oxocyclobutylidene]-2-isocyanoacetonitrile.
| Compound Name | 2-[2,4-bis[cyano(isocyano)methylidene]-3-oxocyclobutylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 72572181 |
| Molecular Formula | C13N6O |
| Molecular Weight | 256.18 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 2-[2,4-bis[cyano(isocyano)methylidene]-3-oxocyclobutylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]C(C#N)=C1C(=O)C(=C(C#N)[N+]#[C-])C1=C(C#N)[N+]#[C-] |
| InChI | InChI=1S/C13N6O/c1-17-7(4-14)10-11(8(5-15)18-2)13(20)12(10)9(6-16)19-3 |
| InChIKey | ITBNORLHHPQWJO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 101.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.18 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|