C12H2I2N4 — CID 158664467
(2Z)-2-[(4Z)-4-[cyano(isocyano)methylidene]-2,5-diiodocyclohexa-2,5-dien-1-ylidene]-2-isocyanoacetonitrile (PubChem CID 158664467) has the molecular formula C12H2I2N4 and a molecular weight of 455.98 g/mol. Its IUPAC name is (2Z)-2-[(4Z)-4-[cyano(isocyano)methylidene]-2,5-diiodocyclohexa-2,5-dien-1-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2Z)-2-[(4Z)-4-[cyano(isocyano)methylidene]-2,5-diiodocyclohexa-2,5-dien-1-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 158664467 |
| Molecular Formula | C12H2I2N4 |
| Molecular Weight | 455.98 g/mol |
| Exact Mass | 455.84 |
| IUPAC Name | (2Z)-2-[(4Z)-4-[cyano(isocyano)methylidene]-2,5-diiodocyclohexa-2,5-dien-1-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=c1/cc(I)/c(=C(/C#N)[N+]#[C-])cc1I |
| InChI | InChI=1S/C12H2I2N4/c1-17-11(5-15)7-3-10(14)8(4-9(7)13)12(6-16)18-2/h3-4H/b11-7-,12-8- |
| InChIKey | QNVKFMQLXMGPKT-OXAWKVHCSA-N |
| XLogP | 2.00 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.98 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|