C16H4N8 — CID 22964366
2-[5-[cyano(isocyano)methylidene]pyrazino[2,3-g]quinoxalin-10-ylidene]-2-isocyanoacetonitrile (PubChem CID 22964366) has the molecular formula C16H4N8 and a molecular weight of 308.26 g/mol. Its IUPAC name is 2-[5-[cyano(isocyano)methylidene]pyrazino[2,3-g]quinoxalin-10-ylidene]-2-isocyanoacetonitrile.
| Compound Name | 2-[5-[cyano(isocyano)methylidene]pyrazino[2,3-g]quinoxalin-10-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 22964366 |
| Molecular Formula | C16H4N8 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 2-[5-[cyano(isocyano)methylidene]pyrazino[2,3-g]quinoxalin-10-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]C(C#N)=c1c2nccnc2c(=C(C#N)[N+]#[C-])c2nccnc12 |
| InChI | InChI=1S/C16H4N8/c1-19-9(7-17)11-13-15(23-5-3-21-13)12(10(8-18)20-2)16-14(11)22-4-6-24-16/h3-6H/b11-9-,12-10+ |
| InChIKey | AWKQLOUTZPVHKI-DSOJMZEYSA-N |
| XLogP | 0.68 |
| TPSA | 107.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|