C10N4O2 — CID 76828554
2-[2-[cyano(isocyano)methylidene]-3,4-dioxocyclobutylidene]-2-isocyanoacetonitrile (PubChem CID 76828554) has the molecular formula C10N4O2 and a molecular weight of 208.14 g/mol. Its IUPAC name is 2-[2-[cyano(isocyano)methylidene]-3,4-dioxocyclobutylidene]-2-isocyanoacetonitrile.
| Compound Name | 2-[2-[cyano(isocyano)methylidene]-3,4-dioxocyclobutylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 76828554 |
| Molecular Formula | C10N4O2 |
| Molecular Weight | 208.14 g/mol |
| Exact Mass | 208.00 |
| IUPAC Name | 2-[2-[cyano(isocyano)methylidene]-3,4-dioxocyclobutylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]C(C#N)=c1c(=O)c(=O)c1=C(C#N)[N+]#[C-] |
| InChI | InChI=1S/C10N4O2/c1-13-5(3-11)7-8(6(4-12)14-2)10(16)9(7)15 |
| InChIKey | ZRMBBCIQNFEGKG-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 90.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.14 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|