C12HCl3N4 — CID 76766325
2-isocyano-2-[2,3,5-trichloro-4-[cyano(isocyano)methylidene]cyclohexa-2,5-dien-1-ylidene]acetonitrile (PubChem CID 76766325) has the molecular formula C12HCl3N4 and a molecular weight of 307.53 g/mol. Its IUPAC name is 2-isocyano-2-[2,3,5-trichloro-4-[cyano(isocyano)methylidene]cyclohexa-2,5-dien-1-ylidene]acetonitrile.
| Compound Name | 2-isocyano-2-[2,3,5-trichloro-4-[cyano(isocyano)methylidene]cyclohexa-2,5-dien-1-ylidene]acetonitrile |
|---|---|
| PubChem CID | 76766325 |
| Molecular Formula | C12HCl3N4 |
| Molecular Weight | 307.53 g/mol |
| Exact Mass | 305.93 |
| IUPAC Name | 2-isocyano-2-[2,3,5-trichloro-4-[cyano(isocyano)methylidene]cyclohexa-2,5-dien-1-ylidene]acetonitrile |
| SMILES | [C-]#[N+]C(C#N)=c1cc(Cl)c(=C(C#N)[N+]#[C-])c(Cl)c1Cl |
| InChI | InChI=1S/C12HCl3N4/c1-18-8(4-16)6-3-7(13)10(9(5-17)19-2)12(15)11(6)14/h3H |
| InChIKey | OBJSXECYEILLOD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.53 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|