C20H8N4 — CID 168853223
(2Z)-2-[(6E)-6-[cyano(isocyano)methylidene]anthracen-2-ylidene]-2-isocyanoacetonitrile (PubChem CID 168853223) has the molecular formula C20H8N4 and a molecular weight of 304.31 g/mol. Its IUPAC name is (2Z)-2-[(6E)-6-[cyano(isocyano)methylidene]anthracen-2-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2Z)-2-[(6E)-6-[cyano(isocyano)methylidene]anthracen-2-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 168853223 |
| Molecular Formula | C20H8N4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | (2Z)-2-[(6E)-6-[cyano(isocyano)methylidene]anthracen-2-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=c1/ccc2cc3c/c(=C(\C#N)[N+]#[C-])ccc3cc2c1 |
| InChI | InChI=1S/C20H8N4/c1-23-19(11-21)15-5-3-13-8-18-10-16(20(12-22)24-2)6-4-14(18)7-17(13)9-15/h3-10H/b19-15-,20-16+ |
| InChIKey | PBPLXJUHOSUGKD-VBGLAJCLSA-N |
| XLogP | 3.10 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|